Structure of PDB 2uyi Chain B Binding Site BS02 |
|
|
Ligand ID | K02 |
InChI | InChI=1S/C19H24N2O2S2/c1-4-21(5-2)19(23)16-13-11-12(3)8-9-14(13)25-18(16)20-17(22)15-7-6-10-24-15/h6-7,10,12H,4-5,8-9,11H2,1-3H3,(H,20,22)/t12-/m1/s1 |
InChIKey | UQKSYQYWUHUIEH-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CCN(CC)C(=O)c1c(NC(=O)c2sccc2)sc3CC[C@@H](C)Cc13 | ACDLabs 10.04 | O=C(c1c3c(sc1NC(=O)c2sccc2)CCC(C3)C)N(CC)CC | CACTVS 3.341 | CCN(CC)C(=O)c1c(NC(=O)c2sccc2)sc3CC[CH](C)Cc13 | OpenEye OEToolkits 1.5.0 | CCN(CC)C(=O)c1c2c(sc1NC(=O)c3cccs3)CCC(C2)C | OpenEye OEToolkits 1.5.0 | CCN(CC)C(=O)c1c2c(sc1NC(=O)c3cccs3)CC[C@H](C2)C |
|
Formula | C19 H24 N2 O2 S2 |
Name | (5R)-N,N-DIETHYL-5-METHYL-2-[(THIOPHEN-2-YLCARBONYL)AMINO]-4,5,6,7-TETRAHYDRO-1-BENZOTHIOPHENE-3-CARBOXAMIDE |
ChEMBL | |
DrugBank | DB08033 |
ZINC | ZINC000016052555
|
PDB chain | 2uyi Chain B Residue 604
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|