Structure of PDB 1xv9 Chain B Binding Site BS02 |
|
|
Ligand ID | CI2 |
InChI | InChI=1S/C21H32O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14,16-19H,4-12H2,1-3H3/t14-,16+,17-,18+,19+,20+,21-/m1/s1 |
InChIKey | XMRPGKVKISIQBV-XWOJZHJZSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C(C)C2C1(CCC4C(C1CC2)CCC3CC(=O)CCC34C)C | OpenEye OEToolkits 1.5.0 | CC(=O)C1CCC2C1(CCC3C2CCC4C3(CCC(=O)C4)C)C | OpenEye OEToolkits 1.5.0 | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CCC(=O)C4)C)C | CACTVS 3.341 | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C | CACTVS 3.341 | CC(=O)[CH]1CC[CH]2[CH]3CC[CH]4CC(=O)CC[C]4(C)[CH]3CC[C]12C |
|
Formula | C21 H32 O2 |
Name | (5BETA)-PREGNANE-3,20-DIONE |
ChEMBL | CHEMBL486954 |
DrugBank | DB07557 |
ZINC | ZINC000003833953
|
PDB chain | 1xv9 Chain D Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|