Structure of PDB 1krv Chain B Binding Site BS02 |
|
|
Ligand ID | 147 |
InChI | InChI=1S/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9+,10+,11-,12-/m1/s1 |
InChIKey | IFBHRQDFSNCLOZ-YBXAARCKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC[C@H]1O[C@@H](Oc2ccc(cc2)[N+]([O-])=O)[C@H](O)[C@@H](O)[C@H]1O | ACDLabs 10.04 | [O-][N+](=O)c2ccc(OC1OC(C(O)C(O)C1O)CO)cc2 | OpenEye OEToolkits 1.5.0 | c1cc(ccc1[N+](=O)[O-])O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O | OpenEye OEToolkits 1.5.0 | c1cc(ccc1[N+](=O)[O-])OC2C(C(C(C(O2)CO)O)O)O | CACTVS 3.341 | OC[CH]1O[CH](Oc2ccc(cc2)[N+]([O-])=O)[CH](O)[CH](O)[CH]1O |
|
Formula | C12 H15 N O8 |
Name | 4-nitrophenyl beta-D-galactopyranoside; 1-O-[P-NITROPHENYL]-BETA-D-GALACTOPYRANOSE; 4-nitrophenyl beta-D-galactoside; 4-nitrophenyl D-galactoside; 4-nitrophenyl galactoside |
ChEMBL | CHEMBL157265 |
DrugBank | DB02632 |
ZINC | ZINC000003956718
|
PDB chain | 1krv Chain B Residue 204
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.3.1.18: galactoside O-acetyltransferase. |
|
|
|