Structure of PDB 6yq3 Chain AAA Binding Site BS02 |
|
|
Ligand ID | P7Q |
InChI | InChI=1S/C20H16O6/c1-20(25)7-9-6-11(21)16-17(14(9)12(22)8-20)18(23)10-4-3-5-13(26-2)15(10)19(16)24/h3-6,21,25H,7-8H2,1-2H3/t20-/m1/s1 |
InChIKey | LQIPGPPZCXJWKY-HXUWFJFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cccc2C(=O)c3c4C(=O)C[C](C)(O)Cc4cc(O)c3C(=O)c12 | OpenEye OEToolkits 2.0.7 | CC1(Cc2cc(c3c(c2C(=O)C1)C(=O)c4cccc(c4C3=O)OC)O)O | OpenEye OEToolkits 2.0.7 | C[C@]1(Cc2cc(c3c(c2C(=O)C1)C(=O)c4cccc(c4C3=O)OC)O)O | CACTVS 3.385 | COc1cccc2C(=O)c3c4C(=O)C[C@](C)(O)Cc4cc(O)c3C(=O)c12 |
|
Formula | C20 H16 O6 |
Name | (3~{R})-8-methoxy-3-methyl-3,6-bis(oxidanyl)-2,4-dihydrobenzo[a]anthracene-1,7,12-trione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6yq3 Chain AAA Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
G17 S149 Y162 |
Catalytic site (residue number reindexed from 1) |
G16 S146 Y159 |
Enzyme Commision number |
? |
|
|
|