Structure of PDB 6tmp Chain AAA Binding Site BS02 |
|
|
Ligand ID | NN8 |
InChI | InChI=1S/C23H22N2O5/c1-29-20-10-14-7-9-25(23(28)17-6-5-16(26)11-19(17)27)22(15-4-3-8-24-13-15)18(14)12-21(20)30-2/h3-6,8,10-13,22,26-27H,7,9H2,1-2H3/t22-/m0/s1 |
InChIKey | CLPZEFHDKKRVHY-QFIPXVFZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc2CCN([CH](c3cccnc3)c2cc1OC)C(=O)c4ccc(O)cc4O | OpenEye OEToolkits 2.0.7 | COc1cc2c(cc1OC)C(N(CC2)C(=O)c3ccc(cc3O)O)c4cccnc4 | CACTVS 3.385 | COc1cc2CCN([C@@H](c3cccnc3)c2cc1OC)C(=O)c4ccc(O)cc4O | OpenEye OEToolkits 2.0.7 | COc1cc2c(cc1OC)[C@@H](N(CC2)C(=O)c3ccc(cc3O)O)c4cccnc4 |
|
Formula | C23 H22 N2 O5 |
Name | [2,4-bis(oxidanyl)phenyl]-[(1~{R})-6,7-dimethoxy-1-pyridin-3-yl-3,4-dihydro-1~{H}-isoquinolin-2-yl]methanone |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6tmp Chain AAA Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|