Structure of PDB 8rdt Chain A Binding Site BS02 |
|
|
Ligand ID | A1HZ2 |
InChI | InChI=1S/C16H18N2O6/c1-21-11-5-4-9(13(22-2)14(11)23-3)10-8-16(24-18-10)7-6-12(19)17-15(16)20/h4-5H,6-8H2,1-3H3,(H,17,19,20)/t16-/m0/s1 |
InChIKey | RKTBPSUWUCWUFM-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc(C2=NO[C@@]3(CCC(=O)NC3=O)C2)c(OC)c1OC | CACTVS 3.385 | COc1ccc(C2=NO[C]3(CCC(=O)NC3=O)C2)c(OC)c1OC | OpenEye OEToolkits 2.0.7 | COc1ccc(c(c1OC)OC)C2=NO[C@]3(C2)CCC(=O)NC3=O | OpenEye OEToolkits 2.0.7 | COc1ccc(c(c1OC)OC)C2=NOC3(C2)CCC(=O)NC3=O |
|
Formula | C16 H18 N2 O6 |
Name | (5~{S})-3-(2,3,4-trimethoxyphenyl)-1-oxa-2,9-diazaspiro[4.5]dec-2-ene-8,10-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8rdt Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|