Structure of PDB 8rdq Chain A Binding Site BS02 |
|
|
Ligand ID | YQO |
InChI | InChI=1S/C13H10Cl2N2O3/c14-7-1-2-8(9(15)5-7)10-6-13(20-17-10)4-3-11(18)16-12(13)19/h1-2,5H,3-4,6H2,(H,16,18,19)/t13-/m0/s1 |
InChIKey | KFAVXUHSPFYSLI-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc(c(cc1Cl)Cl)C2=NOC3(C2)CCC(=O)NC3=O | CACTVS 3.385 | Clc1ccc(c(Cl)c1)C2=NO[C]3(CCC(=O)NC3=O)C2 | OpenEye OEToolkits 2.0.7 | c1cc(c(cc1Cl)Cl)C2=NO[C@]3(C2)CCC(=O)NC3=O | CACTVS 3.385 | Clc1ccc(c(Cl)c1)C2=NO[C@@]3(CCC(=O)NC3=O)C2 |
|
Formula | C13 H10 Cl2 N2 O3 |
Name | (5S)-3-(2,4-dichlorophenyl)-1-oxa-2,9-diazaspiro[4.5]dec-2-ene-8,10-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8rdq Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|