Structure of PDB 8ou5 Chain A Binding Site BS02 |
|
|
Ligand ID | W1X |
InChI | InChI=1S/C13H12F3N3O3/c14-13(15,16)8-5-6(17)1-2-7(8)11(21)18-9-3-4-10(20)19-12(9)22/h1-2,5,9H,3-4,17H2,(H,18,21)(H,19,20,22)/t9-/m0/s1 |
InChIKey | HPKPRXOHNCNKLQ-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc(c(cc1N)C(F)(F)F)C(=O)NC2CCC(=O)NC2=O | CACTVS 3.385 | Nc1ccc(C(=O)N[CH]2CCC(=O)NC2=O)c(c1)C(F)(F)F | OpenEye OEToolkits 2.0.7 | c1cc(c(cc1N)C(F)(F)F)C(=O)N[C@H]2CCC(=O)NC2=O | CACTVS 3.385 | Nc1ccc(C(=O)N[C@H]2CCC(=O)NC2=O)c(c1)C(F)(F)F |
|
Formula | C13 H12 F3 N3 O3 |
Name | 4-azanyl-~{N}-[(3~{S})-2,6-bis(oxidanylidene)piperidin-3-yl]-2-(trifluoromethyl)benzamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8ou5 Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|