Structure of PDB 8oji Chain A Binding Site BS02 |
|
|
Ligand ID | VPH |
InChI | InChI=1S/C8H14O6/c1-13-8(12)5-2-4(10)7(11)6(3-9)14-5/h4-7,9-11H,2-3H2,1H3/t4-,5-,6-,7-/m1/s1 |
InChIKey | GCROCZNWGKBWPY-DBRKOABJSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COC(=O)[C@H]1C[C@@H](O)[C@@H](O)[C@@H](CO)O1 | CACTVS 3.385 | COC(=O)[CH]1C[CH](O)[CH](O)[CH](CO)O1 | OpenEye OEToolkits 2.0.7 | COC(=O)C1CC(C(C(O1)CO)O)O | OpenEye OEToolkits 2.0.7 | COC(=O)[C@H]1C[C@H]([C@H]([C@H](O1)CO)O)O |
|
Formula | C8 H14 O6 |
Name | methyl (2~{R},4~{R},5~{R},6~{R})-6-(hydroxymethyl)-4,5-bis(oxidanyl)oxane-2-carboxylate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8oji Chain A Residue 304
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|