Structure of PDB 8gol Chain A Binding Site BS02 |
|
|
Ligand ID | IJC |
InChI | InChI=1S/C13H11ClN4O6S/c1-24-10-6-9(14)15-12(16-10)17-13(21)18-25(22,23)8-5-3-2-4-7(8)11(19)20/h2-6H,1H3,(H,19,20)(H2,15,16,17,18,21) |
InChIKey | RIUXZHMCCFLRBI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc(Cl)nc(NC(=O)N[S](=O)(=O)c2ccccc2C(O)=O)n1 | OpenEye OEToolkits 2.0.7 | COc1cc(nc(n1)NC(=O)NS(=O)(=O)c2ccccc2C(=O)O)Cl |
|
Formula | C13 H11 Cl N4 O6 S |
Name | 2-[(4-chloranyl-6-methoxy-pyrimidin-2-yl)carbamoylsulfamoyl]benzoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000031333251
|
PDB chain | 8gol Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|