Structure of PDB 8g93 Chain A Binding Site BS02 |
|
|
Ligand ID | YXW |
InChI | InChI=1S/C21H23F2NO4/c22-16-3-1-2-4-19(16)28-12-14-7-9-21(27,10-8-14)13-24-20(26)15-5-6-18(25)17(23)11-15/h1-6,11,14,25,27H,7-10,12-13H2,(H,24,26)/t14-,21- |
InChIKey | GPSLYTIDVZDODP-HNSKJHPRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Oc1ccc(cc1F)C(=O)NC[C]2(O)CC[CH](CC2)COc3ccccc3F | OpenEye OEToolkits 2.0.7 | c1ccc(c(c1)OCC2CCC(CC2)(CNC(=O)c3ccc(c(c3)F)O)O)F | CACTVS 3.385 | Oc1ccc(cc1F)C(=O)NC[C@@]2(O)CC[C@H](CC2)COc3ccccc3F | ACDLabs 12.01 | OC1(CNC(=O)c2ccc(O)c(F)c2)CCC(CC1)COc1ccccc1F |
|
Formula | C21 H23 F2 N O4 |
Name | 3-fluoro-N-({(1r,4r)-4-[(2-fluorophenoxy)methyl]-1-hydroxycyclohexyl}methyl)-4-hydroxybenzamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8g93 Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|