Structure of PDB 8fjo Chain A Binding Site BS02 |
|
|
Ligand ID | Y7R |
InChI | InChI=1S/C17H28O2/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-19-17(5)18/h8,10,12H,6-7,9,11,13H2,1-5H3/b15-10+,16-12+ |
InChIKey | ZGIGZINMAOQWLX-NCZFFCEISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(=O)OC\C=C(C)\CC/C=C(C)/CCC=C(C)C | ACDLabs 12.01 | CC(=O)OC\C=C(/C)CC\C=C(/C)CC\C=C(/C)C | OpenEye OEToolkits 2.0.7 | CC(=CCC/C(=C/CC/C(=C/COC(=O)C)/C)/C)C | OpenEye OEToolkits 2.0.7 | CC(=CCCC(=CCCC(=CCOC(=O)C)C)C)C | CACTVS 3.385 | CC(=O)OCC=C(C)CCC=C(C)CCC=C(C)C |
|
Formula | C17 H28 O2 |
Name | (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl acetate; (2E,6E)-farnesyl acetate |
ChEMBL | CHEMBL3184169 |
DrugBank | |
ZINC | ZINC000001719908
|
PDB chain | 8fjo Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|