Structure of PDB 8ewl Chain A Binding Site BS02 |
|
|
Ligand ID | X1C |
InChI | InChI=1S/C19H18N4O.2C15H10N.Ir/c24-19(7-5-15-8-11-20-12-9-15)23-14-16-4-6-18(22-13-16)17-3-1-2-10-21-17;2*1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;/h1-4,6,8-13H,5,7,14H2,(H,23,24);2*1-6,8-11H;/q;;;+1 |
InChIKey | WEVFFROKHIBXQX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(CCc1ccncc1)NCc1ccc2c3ccccn3[Ir+]34(c5ccccc5c5ccc6ccccc6n53)(c3ccccc3c3ccc5ccccc5n34)n2c1 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)C=CC3=[N]2[Ir+]45(c6c3cccc6)(c7ccccc7C8=CC=C9C=CC=CC9=[N]48)[N]1=C(C=CC=C1)C1=[N]5C=C(C=C1)CNC(=O)CCc1ccncc1 | CACTVS 3.385 | O=C(CCc1ccncc1)NCc2ccc(nc2)c3ccccn3.[Ir+](c4ccccc4c5ccc6ccccc6n5)c7ccccc7c8ccc9ccccc9n8 |
|
Formula | C49 H38 Ir N6 O |
Name | {N-[([2,2'-bipyridin]-5-yl-kappa~2~N~1~,N~1'~)methyl]-3-(pyridin-4-yl)propanamide}bis[2-(quinolin-2-yl-kappaN)phenyl-kappaC~1~]iridium(1+) |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8ewl Chain A Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.14.14.1: unspecific monooxygenase. 1.14.14.55: quinine 3-monooxygenase. 1.14.14.56: 1,8-cineole 2-exo-monooxygenase. 1.14.14.73: albendazole monooxygenase (sufoxide-forming). |
|
|
Molecular Function |
GO:0004497 |
monooxygenase activity |
GO:0005496 |
steroid binding |
GO:0005506 |
iron ion binding |
GO:0005515 |
protein binding |
GO:0008395 |
steroid hydroxylase activity |
GO:0008401 |
retinoic acid 4-hydroxylase activity |
GO:0016491 |
oxidoreductase activity |
GO:0016705 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen |
GO:0016712 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen |
GO:0019825 |
oxygen binding |
GO:0019899 |
enzyme binding |
GO:0020037 |
heme binding |
GO:0030343 |
vitamin D3 25-hydroxylase activity |
GO:0034875 |
caffeine oxidase activity |
GO:0046872 |
metal ion binding |
GO:0050591 |
quinine 3-monooxygenase activity |
GO:0050649 |
testosterone 6-beta-hydroxylase activity |
GO:0062181 |
1-alpha,25-dihydroxyvitamin D3 23-hydroxylase activity |
GO:0062187 |
anandamide 8,9 epoxidase activity |
GO:0062188 |
anandamide 11,12 epoxidase activity |
GO:0062189 |
anandamide 14,15 epoxidase activity |
GO:0070330 |
aromatase activity |
GO:0070576 |
vitamin D 24-hydroxylase activity |
GO:0101020 |
estrogen 16-alpha-hydroxylase activity |
GO:0101021 |
estrogen 2-hydroxylase activity |
GO:0102320 |
1,8-cineole 2-exo-monooxygenase activity |
|
|