Structure of PDB 8ew1 Chain A Binding Site BS02 |
|
|
Ligand ID | L6S |
InChI | InChI=1S/C6H12O9S/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-10H,1H2,(H,11,12,13)/t2-,3+,4+,5-,6+/m0/s1 |
InChIKey | OKUVUONOJCDUJY-SXUWKVJYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 11.02 | O=S(=O)(O)OCC1OC(O)C(O)C(O)C1O | OpenEye OEToolkits 1.7.0 | C(C1C(C(C(C(O1)O)O)O)O)OS(=O)(=O)O | OpenEye OEToolkits 1.7.0 | C([C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)O)O)O)O)OS(=O)(=O)O | CACTVS 3.352 | O[CH]1O[CH](CO[S](O)(=O)=O)[CH](O)[CH](O)[CH]1O | CACTVS 3.352 | O[C@@H]1O[C@@H](CO[S](O)(=O)=O)[C@@H](O)[C@@H](O)[C@@H]1O |
|
Formula | C6 H12 O9 S |
Name | 6-O-sulfo-alpha-L-galactopyranose; 6-O-sulfo-alpha-L-galactose; 6-O-sulfo-L-galactose; 6-O-sulfo-galactose |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8ew1 Chain D Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|