Structure of PDB 8csc Chain A Binding Site BS02 |
|
|
Ligand ID | KDO |
InChI | InChI=1S/C8H14O8/c9-2-4(11)6-5(12)3(10)1-8(15,16-6)7(13)14/h3-6,9-12,15H,1-2H2,(H,13,14)/t3-,4-,5-,6-,8-/m1/s1 |
InChIKey | NNLZBVFSCVTSLA-HXUQBWEZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC[C@@H](O)[C@H]1O[C@](O)(C[C@@H](O)[C@H]1O)C(O)=O | OpenEye OEToolkits 1.5.0 | C1[C@H]([C@H]([C@H](O[C@]1(C(=O)O)O)[C@@H](CO)O)O)O | OpenEye OEToolkits 1.5.0 | C1C(C(C(OC1(C(=O)O)O)C(CO)O)O)O | CACTVS 3.341 | OC[CH](O)[CH]1O[C](O)(C[CH](O)[CH]1O)C(O)=O | ACDLabs 10.04 | O=C(O)C1(O)OC(C(O)CO)C(O)C(O)C1 |
|
Formula | C8 H14 O8 |
Name | 3-deoxy-alpha-D-manno-oct-2-ulopyranosonic acid; 3-deoxy-d-manno-oct-2-ulopyranosonic acid; 2-keto-3-deoxy-D-mannooctanoic acid; 3-deoxy-alpha-D-manno-oct-2-ulosonic acid; 3-deoxy-D-manno-oct-2-ulosonic acid; 3-deoxy-manno-oct-2-ulosonic acid |
ChEMBL | |
DrugBank | DB03548 |
ZINC | ZINC000005851513
|
PDB chain | 8csc Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|