Structure of PDB 8cjo Chain A Binding Site BS02 |
|
|
Ligand ID | UWL |
InChI | InChI=1S/C26H28ClFN4O2/c1-3-20-22(10-7-16(2)29-20)34-15-24(33)32-13-11-21-26(31-12-5-4-6-23(31)30-21)25(32)18-9-8-17(27)14-19(18)28/h7-10,14,25H,3-6,11-13,15H2,1-2H3/t25-/m0/s1 |
InChIKey | DWIGWIZFMAXRAR-VWLOTQADSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCc1nc(C)ccc1OCC(=O)N2CCc3nc4CCCCn4c3[C@@H]2c5ccc(Cl)cc5F | OpenEye OEToolkits 2.0.7 | CCc1c(ccc(n1)C)OCC(=O)N2CCc3c(n4c(n3)CCCC4)C2c5ccc(cc5F)Cl | OpenEye OEToolkits 2.0.7 | CCc1c(ccc(n1)C)OCC(=O)N2CCc3c(n4c(n3)CCCC4)[C@@H]2c5ccc(cc5F)Cl | CACTVS 3.385 | CCc1nc(C)ccc1OCC(=O)N2CCc3nc4CCCCn4c3[CH]2c5ccc(Cl)cc5F |
|
Formula | C26 H28 Cl F N4 O2 |
Name | 1-[(3~{S})-3-(4-chloranyl-2-fluoranyl-phenyl)-1,4,8-triazatricyclo[7.4.0.0^{2,7}]trideca-2(7),8-dien-4-yl]-2-(2-ethyl-6-methyl-pyridin-3-yl)oxy-ethanone |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8cjo Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.14.16.4: tryptophan 5-monooxygenase. |
|
|
Molecular Function |
GO:0004497 |
monooxygenase activity |
GO:0005506 |
iron ion binding |
GO:0016714 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen |
|
|