Structure of PDB 8cb0 Chain A Binding Site BS02 |
|
|
Ligand ID | U4F |
InChI | InChI=1S/C23H20N2O3/c26-22-16-5-2-1-4-15(16)18-14-20(24-19-7-3-6-17(22)21(18)19)25-10-8-23(9-11-25)27-12-13-28-23/h1-7,14H,8-13H2 |
InChIKey | WRRCVQZTYRSVQE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)-c3cc(nc4c3c(ccc4)C2=O)N5CCC6(CC5)OCCO6 | CACTVS 3.385 | O=C1c2ccccc2c3cc(nc4cccc1c34)N5CCC6(CC5)OCCO6 |
|
Formula | C23 H20 N2 O3 |
Name | 15-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-14-azatetracyclo[7.7.1.0^{2,7}.0^{13,17}]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-8-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000020623001
|
PDB chain | 8cb0 Chain A Residue 802
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|