Structure of PDB 8bhs Chain A Binding Site BS02 |
|
|
Ligand ID | QK9 |
InChI | InChI=1S/C13H8BrF2N5/c14-7-1-2-9-8(3-7)13-17-5-19-21(13)4-10-11(12(15)16)18-6-20(9)10/h1-3,5-6,12H,4H2 |
InChIKey | AFJRYPJIKHMNGL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | FC(F)c1ncn2c1Cn3ncnc3c4cc(Br)ccc24 | OpenEye OEToolkits 3.1.0.0 | c1cc-2c(cc1Br)-c3ncnn3Cc4n2cnc4C(F)F |
|
Formula | C13 H8 Br F2 N5 |
Name | 5-[bis(fluoranyl)methyl]-15-bromanyl-2,4,8,9,11-pentazatetracyclo[11.4.0.0^{2,6}.0^{8,12}]heptadeca-1(13),3,5,9,11,14,16-heptaene |
ChEMBL | CHEMBL1080588 |
DrugBank | |
ZINC | ZINC000035950127
|
PDB chain | 8bhs Chain B Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|