Structure of PDB 8aop Chain A Binding Site BS02 |
|
|
Ligand ID | MW6 |
InChI | InChI=1S/C12H14N2O2S/c13-9-2-1-3-10(6-9)17-7-8-4-5-11(15)14-12(8)16/h1-3,6,8H,4-5,7,13H2,(H,14,15,16)/t8-/m1/s1 |
InChIKey | YGPLIXYOXPSSRZ-MRVPVSSYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1cccc(SC[C@H]2CCC(=O)NC2=O)c1 | OpenEye OEToolkits 2.0.7 | c1cc(cc(c1)SCC2CCC(=O)NC2=O)N | CACTVS 3.385 | Nc1cccc(SC[CH]2CCC(=O)NC2=O)c1 | OpenEye OEToolkits 2.0.7 | c1cc(cc(c1)SC[C@H]2CCC(=O)NC2=O)N |
|
Formula | C12 H14 N2 O2 S |
Name | (3S)-3-[(3-aminophenyl)sulfanylmethyl]piperidine-2,6-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 8aop Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|