Structure of PDB 7zwr Chain A Binding Site BS02 |
|
|
Ligand ID | K4X |
InChI | InChI=1S/C16H16F3N3O3S/c1-8-2-3-11-9(4-8)14(16(17,18)19)10(5-20)15(22-11)26-7-12(23)21-6-13(24)25/h8H,2-4,6-7H2,1H3,(H,21,23)(H,24,25)/t8-/m0/s1 |
InChIKey | WFZYCKQTMOLOHC-QMMMGPOBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH]1CCc2nc(SCC(=O)NCC(O)=O)c(C#N)c(c2C1)C(F)(F)F | OpenEye OEToolkits 2.0.7 | CC1CCc2c(c(c(c(n2)SCC(=O)NCC(=O)O)C#N)C(F)(F)F)C1 | CACTVS 3.385 | C[C@H]1CCc2nc(SCC(=O)NCC(O)=O)c(C#N)c(c2C1)C(F)(F)F | OpenEye OEToolkits 2.0.7 | C[C@H]1CCc2c(c(c(c(n2)SCC(=O)NCC(=O)O)C#N)C(F)(F)F)C1 |
|
Formula | C16 H16 F3 N3 O3 S |
Name | 2-[2-[[(6~{S})-3-cyano-6-methyl-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinolin-2-yl]sulfanyl]ethanoylamino]ethanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000008382625
|
PDB chain | 7zwr Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|