Structure of PDB 7z2i Chain A Binding Site BS02 |
|
|
Ligand ID | I9O |
InChI | InChI=1S/C14H14F3N3/c15-14(16,17)11-3-1-2-10(6-11)7-20-5-4-12-13(8-20)19-9-18-12/h1-3,6,9H,4-5,7-8H2,(H,18,19) |
InChIKey | FOPKRYDZNCKFAQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc(cc(c1)C(F)(F)F)CN2CCc3c(nc[nH]3)C2 | CACTVS 3.385 | FC(F)(F)c1cccc(CN2CCc3[nH]cnc3C2)c1 |
|
Formula | C14 H14 F3 N3 |
Name | 5-[[3-(trifluoromethyl)phenyl]methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000097301342
|
PDB chain | 7z2i Chain A Residue 306
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.4.21.4: trypsin. |
|
|
|