Structure of PDB 7u1m Chain A Binding Site BS02 |
|
|
Ligand ID | KYF |
InChI | InChI=1S/C20H24FN3O2S/c1-20(2,17-12-27-18(22-17)14-3-5-15(21)6-4-14)23-19(25)26-16-11-24-9-7-13(16)8-10-24/h3-6,12-13,16H,7-11H2,1-2H3,(H,23,25)/t16-/m1/s1 |
InChIKey | YFHRCLAKZBDRHN-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(C)(c1csc(n1)c2ccc(cc2)F)NC(=O)OC3CN4CCC3CC4 | CACTVS 3.385 | CC(C)(NC(=O)O[C@@H]1CN2CCC1CC2)c3csc(n3)c4ccc(F)cc4 | OpenEye OEToolkits 2.0.7 | CC(C)(c1csc(n1)c2ccc(cc2)F)NC(=O)O[C@@H]3CN4CCC3CC4 | ACDLabs 12.01 | O=C(OC1CN2CCC1CC2)NC(C)(C)c1csc(n1)c1ccc(F)cc1 | CACTVS 3.385 | CC(C)(NC(=O)O[CH]1CN2CCC1CC2)c3csc(n3)c4ccc(F)cc4 |
|
Formula | C20 H24 F N3 O2 S |
Name | (1R,3S,4R)-1-azabicyclo[2.2.2]octan-3-yl {2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl}carbamate |
ChEMBL | CHEMBL4297611 |
DrugBank | DB14966 |
ZINC | ZINC000202143443
|
PDB chain | 7u1m Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.1.1.244: protein N-terminal methyltransferase. |
|
|
|