Structure of PDB 7rhk Chain A Binding Site BS02 |
|
|
Ligand ID | 5H0 |
InChI | InChI=1S/C22H26N2O4S/c1-15(25)28-20-21(16-9-11-17(27-4)12-10-16)29-19-8-6-5-7-18(19)24(22(20)26)14-13-23(2)3/h5-12,20-21H,13-14H2,1-4H3/t20-,21+/m0/s1 |
InChIKey | HSUGRBWQSSZJOP-LEWJYISDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc(cc1)[CH]2Sc3ccccc3N(CCN(C)C)C(=O)[CH]2OC(C)=O | OpenEye OEToolkits 2.0.7 | CC(=O)O[C@H]1[C@H](Sc2ccccc2N(C1=O)CCN(C)C)c3ccc(cc3)OC | CACTVS 3.385 | COc1ccc(cc1)[C@H]2Sc3ccccc3N(CCN(C)C)C(=O)[C@H]2OC(C)=O | ACDLabs 12.01 | CN(C)CCN1c2ccccc2SC(C(OC(C)=O)C1=O)c1ccc(OC)cc1 | OpenEye OEToolkits 2.0.7 | CC(=O)OC1C(Sc2ccccc2N(C1=O)CCN(C)C)c3ccc(cc3)OC |
|
Formula | C22 H26 N2 O4 S |
Name | (2R,3R)-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl acetate |
ChEMBL | CHEMBL1397935 |
DrugBank | |
ZINC | ZINC000000601259
|
PDB chain | 7rhk Chain A Residue 1102
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|