Structure of PDB 7kje Chain A Binding Site BS02 |
|
|
Ligand ID | NRD |
InChI | InChI=1S/C6H17NO7P2/c7-5-3-1-2-4-6(8,15(9,10)11)16(12,13)14/h8H,1-5,7H2,(H2,9,10,11)(H2,12,13,14) |
InChIKey | PUUSSSIBPPTKTP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | C(CCC(O)(P(=O)(O)O)P(=O)(O)O)CCN | CACTVS 3.385 | NCCCCCC(O)([P](O)(O)=O)[P](O)(O)=O |
|
Formula | C6 H17 N O7 P2 |
Name | (6-azanyl-1-oxidanyl-1-phosphono-hexyl)phosphonic acid |
ChEMBL | CHEMBL55214 |
DrugBank | DB11620 |
ZINC | ZINC000001999491
|
PDB chain | 7kje Chain A Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|