Structure of PDB 7k6z Chain A Binding Site BS02 |
|
|
Ligand ID | VZD |
InChI | InChI=1S/C15H17FN4O5S2/c16-11-1-3-12(4-2-11)19-15(21)18-9-10-26(22,23)20-13-5-7-14(8-6-13)27(17,24)25/h1-8,20H,9-10H2,(H2,17,24,25)(H2,18,19,21) |
InChIKey | RNTJUUSYPCOMRZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | N(c1ccc(F)cc1)C(NCCS(Nc2ccc(cc2)S(N)(=O)=O)(=O)=O)=O | CACTVS 3.385 | N[S](=O)(=O)c1ccc(N[S](=O)(=O)CCNC(=O)Nc2ccc(F)cc2)cc1 | OpenEye OEToolkits 2.0.7 | c1cc(ccc1NC(=O)NCCS(=O)(=O)Nc2ccc(cc2)S(=O)(=O)N)F |
|
Formula | C15 H17 F N4 O5 S2 |
Name | 4-{[(2-{[(4-fluorophenyl)carbamoyl]amino}ethyl)sulfonyl]amino}benzene-1-sulfonamide |
ChEMBL | CHEMBL4781400 |
DrugBank | |
ZINC |
|
PDB chain | 7k6z Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|