Structure of PDB 7jnr Chain A Binding Site BS02 |
|
|
Ligand ID | VFG |
InChI | InChI=1S/C5H8N4O3S2/c1-2-3(10)7-4-8-9-5(13-4)14(6,11)12/h2H2,1H3,(H2,6,11,12)(H,7,8,10) |
InChIKey | PCBBBQKRWNGNDW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CCC(=O)Nc1nnc(s1)S(=O)(=O)N | ACDLabs 12.01 | CCC(=O)Nc1nnc(S(N)(=O)=O)s1 | CACTVS 3.385 | CCC(=O)Nc1sc(nn1)[S](N)(=O)=O |
|
Formula | C5 H8 N4 O3 S2 |
Name | N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide |
ChEMBL | CHEMBL1288786 |
DrugBank | |
ZINC | ZINC000004217364
|
PDB chain | 7jnr Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|