Structure of PDB 7d8e Chain A Binding Site BS02 |
|
|
Ligand ID | GYO |
InChI | InChI=1S/C18H17N3O2/c1-23-17-5-3-2-4-12(17)13-9-15(13)21-18(22)11-6-7-14-16(8-11)20-10-19-14/h2-8,10,13,15H,9H2,1H3,(H,19,20)(H,21,22)/t13-,15-/m0/s1 |
InChIKey | ZKYVGLRMGWYWNE-ZFWWWQNUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccccc1[CH]2C[CH]2NC(=O)c3ccc4nc[nH]c4c3 | CACTVS 3.385 | COc1ccccc1[C@@H]2C[C@@H]2NC(=O)c3ccc4nc[nH]c4c3 | OpenEye OEToolkits 2.0.7 | COc1ccccc1[C@@H]2C[C@@H]2NC(=O)c3ccc4c(c3)[nH]cn4 | OpenEye OEToolkits 2.0.7 | COc1ccccc1C2CC2NC(=O)c3ccc4c(c3)[nH]cn4 |
|
Formula | C18 H17 N3 O2 |
Name | ~{N}-[(1~{S},2~{S})-2-(2-methoxyphenyl)cyclopropyl]-3~{H}-benzimidazole-5-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000069537463
|
PDB chain | 7d8e Chain A Residue 1008
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.3.2.5: glutaminyl-peptide cyclotransferase. |
|
|
|