Structure of PDB 6zfh Chain A Binding Site BS02 |
|
|
Ligand ID | QV2 |
InChI | InChI=1S/C19H20N4O2/c24-14-8-5-7-13-16(14)19(10-3-4-11-19)23-17(20-13)22-18-21-12-6-1-2-9-15(12)25-18/h1-2,6,9H,3-5,7-8,10-11H2,(H2,20,21,22,23) |
InChIKey | FDNVTCDQGOVLPM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O=C1CCCC2=C1C3(CCCC3)N=C(N2)Nc4oc5ccccc5n4 | OpenEye OEToolkits 2.0.7 | c1ccc2c(c1)nc(o2)NC3=NC4(CCCC4)C5=C(N3)CCCC5=O |
|
Formula | C19 H20 N4 O2 |
Name | 2-(1,3-benzoxazol-2-ylamino)spiro[1,6,7,8-tetrahydroquinazoline-4,1'-cyclopentane]-5-one |
ChEMBL | CHEMBL1347128 |
DrugBank | |
ZINC | ZINC000006498864
|
PDB chain | 6zfh Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.6: galactokinase. |
|
|
|