Structure of PDB 6z28 Chain A Binding Site BS02 |
|
|
Ligand ID | 3K0 |
InChI | InChI=1S/C5H10N2O6S/c6-14(12,13)7-3(5(10)11)1-2-4(8)9/h3,7H,1-2H2,(H,8,9)(H,10,11)(H2,6,12,13)/t3-/m0/s1 |
InChIKey | ZYYFXKZXQCQRTJ-VKHMYHEASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | C(CC(=O)O)[C@@H](C(=O)O)NS(=O)(=O)N | CACTVS 3.385 | N[S](=O)(=O)N[C@@H](CCC(O)=O)C(O)=O | OpenEye OEToolkits 1.9.2 | C(CC(=O)O)C(C(=O)O)NS(=O)(=O)N | ACDLabs 12.01 | O=S(=O)(NC(C(=O)O)CCC(=O)O)N | CACTVS 3.385 | N[S](=O)(=O)N[CH](CCC(O)=O)C(O)=O |
|
Formula | C5 H10 N2 O6 S |
Name | N-sulfamoyl-L-glutamic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6z28 Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|