Structure of PDB 6yzr Chain A Binding Site BS02 |
|
|
Ligand ID | Q3W |
InChI | InChI=1S/C6H10B9NO2S/c16-19(17,18)4-2-1-3-6-5-7-9-8(6)12(6)10(5,6)11(5,7)13(7,9)14(8,9,12)15(10,11,12)13/h1-4H2,(H2,16,17,18) |
InChIKey | GIOOYPGZXWIHKJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | B123B45B167B289B31B823B966B744B622C45C321CCCCS(=O)(=O)N | CACTVS 3.385 | N[S](=O)(=O)CCCC[C+]123[B-]45[B-]67[B+]89[C]1%10[B]8%11%12[B]69%13[B]47%14[B]25%15[B]3%10%11[B]%12%13%14%15 | CACTVS 3.385 | N[S](=O)(=O)CCCC[C+]123[B-]45[B-]67[B+]89[C@@]1%10[B]8%11%12[B]69%13[B]47%14[B]25%15[B]3%10%11[B]%12%13%14%15 |
|
Formula | C6 H10 B9 N O2 S |
Name | Carborane nido-butyl-sulfonamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6yzr Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|