Structure of PDB 6ytg Chain A Binding Site BS02 |
|
|
Ligand ID | KHC |
InChI | InChI=1S/C17H16Cl2N4O/c1-23-14-9(2-3-11(18)13(14)19)12-10(8-20)17(4-6-21-7-5-17)22-16(24)15(12)23/h2-3,10,21H,4-7H2,1H3,(H,22,24)/t10-/m0/s1 |
InChIKey | OWAWOKKHZNRHGV-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cn1c2c(ccc(c2Cl)Cl)c3c1C(=O)NC4(C3C#N)CCNCC4 | CACTVS 3.385 | Cn1c2c(Cl)c(Cl)ccc2c3[C@H](C#N)C4(CCNCC4)NC(=O)c13 | OpenEye OEToolkits 2.0.7 | Cn1c2c(ccc(c2Cl)Cl)c3c1C(=O)NC4([C@H]3C#N)CCNCC4 | CACTVS 3.385 | Cn1c2c(Cl)c(Cl)ccc2c3[CH](C#N)C4(CCNCC4)NC(=O)c13 |
|
Formula | C17 H16 Cl2 N4 O |
Name | (4~{S})-7,8-bis(chloranyl)-9-methyl-1-oxidanylidene-spiro[2,4-dihydropyrido[3,4-b]indole-3,4'-piperidine]-4-carbonitrile |
ChEMBL | |
DrugBank | |
ZINC | ZINC000073197039
|
PDB chain | 6ytg Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|