Structure of PDB 6yh6 Chain A Binding Site BS02 |
|
|
|
| Ligand ID | OQW |
| InChI | InChI=1S/C14H19F3N2O2S/c15-10-8-11(16)13(14(12(10)17)22(18,20)21)19-9-6-4-2-1-3-5-7-9/h8-9,19H,1-7H2,(H2,18,20,21) |
| InChIKey | CRSVSKVDNXYYQV-UHFFFAOYSA-N |
| SMILES | | Software | SMILES |
|---|
| CACTVS 3.385 | N[S](=O)(=O)c1c(F)c(F)cc(F)c1NC2CCCCCCC2 | | OpenEye OEToolkits 2.0.7 | c1c(c(c(c(c1F)F)S(=O)(=O)N)NC2CCCCCCC2)F |
|
| Formula | C14 H19 F3 N2 O2 S |
| Name | 2-(Cyclooctylamino)-3,5,6-trifluorobenzenesulfonamide;
2-(cyclooctylamino)-3,5,6-tris(fluoranyl)benzenesulfonamide |
| ChEMBL | |
| DrugBank | |
| ZINC |
|
| PDB chain | 6yh6 Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|
|
|
|
|
