Structure of PDB 6wq7 Chain A Binding Site BS02 |
|
|
Ligand ID | U6V |
InChI | InChI=1S/C28H35FN4O3S/c29-26-11-7-25(8-12-26)21-33(20-16-24-9-13-27(14-10-24)37(31,35)36)28(34)22-32(18-4-17-30)19-15-23-5-2-1-3-6-23/h1-3,5-14H,4,15-22,30H2,(H2,31,35,36) |
InChIKey | PTOFZDQATQXAPS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NCCCN(CCc1ccccc1)CC(=O)N(CCc2ccc(cc2)[S](N)(=O)=O)Cc3ccc(F)cc3 | OpenEye OEToolkits 2.0.7 | c1ccc(cc1)CCN(CCCN)CC(=O)N(CCc2ccc(cc2)S(=O)(=O)N)Cc3ccc(cc3)F | ACDLabs 12.01 | C(c1ccc(F)cc1)N(CCc2ccc(cc2)S(N)(=O)=O)C(CN(CCc3ccccc3)CCCN)=O |
|
Formula | C28 H35 F N4 O3 S |
Name | N~2~-(3-aminopropyl)-N-[(4-fluorophenyl)methyl]-N~2~-(2-phenylethyl)-N-[2-(4-sulfamoylphenyl)ethyl]glycinamide |
ChEMBL | CHEMBL4637053 |
DrugBank | |
ZINC |
|
PDB chain | 6wq7 Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|