Structure of PDB 6vus Chain A Binding Site BS02 |
|
|
Ligand ID | RNV |
InChI | InChI=1S/C18H27N5OS2/c1-3-23(4-2)10-9-20-14(24)11-25-18-21-16(19)15-12-7-5-6-8-13(12)26-17(15)22-18/h3-11H2,1-2H3,(H,20,24)(H2,19,21,22) |
InChIKey | IQQWKKVZCVYLKR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCN(CC)CCNC(=O)CSc1nc(N)c2c3CCCCc3sc2n1 | OpenEye OEToolkits 2.0.7 | CCN(CC)CCNC(=O)CSc1nc(c2c3c(sc2n1)CCCC3)N | ACDLabs 12.01 | C(CNC(CSc1nc(N)c2c(n1)sc3c2CCCC3)=O)N(CC)CC |
|
Formula | C18 H27 N5 O S2 |
Name | 2-[(4-amino-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-2-yl)sulfanyl]-N-[2-(diethylamino)ethyl]acetamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6vus Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
Biological Process |
GO:0030649 |
aminoglycoside antibiotic catabolic process |
GO:0033661 |
effector-mediated defense to host-produced reactive oxygen species |
GO:0034054 |
symbiont-mediated suppression of host defense-related programmed cell death |
GO:0046677 |
response to antibiotic |
GO:0051701 |
biological process involved in interaction with host |
GO:0052032 |
symbiont-mediated perturbation of host inflammatory response |
GO:0052040 |
symbiont-mediated perturbation of host programmed cell death |
GO:0052167 |
symbiont-mediated perturbation of host innate immune response |
|
|