Structure of PDB 6uzu Chain A Binding Site BS02 |
|
|
Ligand ID | 6LU |
InChI | InChI=1S/C15H17N3O3S/c1-10-7-11(2)9-13(8-10)18-15(19)17-12-3-5-14(6-4-12)22(16,20)21/h3-9H,1-2H3,(H2,16,20,21)(H2,17,18,19) |
InChIKey | SPEYBQKWONGMOH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | Cc1cc(cc(c1)NC(=O)Nc2ccc(cc2)S(=O)(=O)N)C | ACDLabs 12.01 | Cc1cc(cc(c1)C)NC(=O)Nc2ccc(S(=O)(=O)N)cc2 | CACTVS 3.385 | Cc1cc(C)cc(NC(=O)Nc2ccc(cc2)[S](N)(=O)=O)c1 |
|
Formula | C15 H17 N3 O3 S |
Name | 4-{[(3,5-dimethylphenyl)carbamoyl]amino}benzene-1-sulfonamide |
ChEMBL | CHEMBL1643306 |
DrugBank | |
ZINC | ZINC000018172548
|
PDB chain | 6uzu Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|