Structure of PDB 6upg Chain A Binding Site BS02 |
|
|
Ligand ID | KEQ |
InChI | InChI=1S/C19H20N2O4/c1-25-15-8-4-13(5-9-15)11-17-19(24)20-16(18(23)21-17)10-12-2-6-14(22)7-3-12/h2-9,16-17,22H,10-11H2,1H3,(H,20,24)(H,21,23)/t16-,17-/m0/s1 |
InChIKey | SXIBGFQFSYRUSU-IRXDYDNUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1ccc(C[C@@H]2NC(=O)[C@H](Cc3ccc(O)cc3)NC2=O)cc1 | OpenEye OEToolkits 2.0.7 | COc1ccc(cc1)CC2C(=O)NC(C(=O)N2)Cc3ccc(cc3)O | OpenEye OEToolkits 2.0.7 | COc1ccc(cc1)C[C@H]2C(=O)N[C@H](C(=O)N2)Cc3ccc(cc3)O | CACTVS 3.385 | COc1ccc(C[CH]2NC(=O)[CH](Cc3ccc(O)cc3)NC2=O)cc1 |
|
Formula | C19 H20 N2 O4 |
Name | (3~{S},6~{S})-3-[(4-hydroxyphenyl)methyl]-6-[(4-methoxyphenyl)methyl]piperazine-2,5-dione |
ChEMBL | CHEMBL4447064 |
DrugBank | |
ZINC |
|
PDB chain | 6upg Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|