Structure of PDB 6ugz Chain A Binding Site BS02 |
|
|
Ligand ID | Q71 |
InChI | InChI=1S/C7H5FN2O3S/c8-4-1-2-5-6(3-4)14(12,13)10-7(11)9-5/h1-3H,(H2,9,10,11) |
InChIKey | ITUAGWGFDMMEMY-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Fc1ccc2NC(=O)N[S](=O)(=O)c2c1 | OpenEye OEToolkits 2.0.7 | c1cc2c(cc1F)S(=O)(=O)NC(=O)N2 | ACDLabs 12.01 | c1(F)cc2c(cc1)NC(NS2(=O)=O)=O |
|
Formula | C7 H5 F N2 O3 S |
Name | 7-fluoro-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione |
ChEMBL | CHEMBL4571323 |
DrugBank | |
ZINC | ZINC000038236008
|
PDB chain | 6ugz Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|