Structure of PDB 6u4q Chain A Binding Site BS02 |
|
|
Ligand ID | PX7 |
InChI | InChI=1S/C8H8N2O3S/c1-10-6-4-2-3-5-7(6)14(12,13)9-8(10)11/h2-5H,1H3,(H,9,11) |
InChIKey | RQCMUVKZNMGOOY-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1C(=O)N[S](=O)(=O)c2ccccc12 | ACDLabs 12.01 | N2S(c1ccccc1N(C2=O)C)(=O)=O | OpenEye OEToolkits 2.0.7 | CN1c2ccccc2S(=O)(=O)NC1=O |
|
Formula | C8 H8 N2 O3 S |
Name | 4-methyl-1lambda~6~,2,4-benzothiadiazine-1,1,3(2H,4H)-trione |
ChEMBL | CHEMBL4521083 |
DrugBank | |
ZINC | ZINC000015443491
|
PDB chain | 6u4q Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|