Structure of PDB 6too Chain A Binding Site BS02 |
|
|
Ligand ID | NR8 |
InChI | InChI=1S/C18H18ClN5O2/c1-3-12(25)10-24-16-8-11(4-5-15(16)23(2)18(24)26)22-14-6-7-21-17(19)13(14)9-20/h4-8,12,25H,3,10H2,1-2H3,(H,21,22)/t12-/m0/s1 |
InChIKey | YYQGUWHFXVXQOO-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC[C@H](O)CN1C(=O)N(C)c2ccc(Nc3ccnc(Cl)c3C#N)cc12 | CACTVS 3.385 | CC[CH](O)CN1C(=O)N(C)c2ccc(Nc3ccnc(Cl)c3C#N)cc12 | OpenEye OEToolkits 2.0.7 | CC[C@@H](CN1c2cc(ccc2N(C1=O)C)Nc3ccnc(c3C#N)Cl)O | OpenEye OEToolkits 2.0.7 | CCC(CN1c2cc(ccc2N(C1=O)C)Nc3ccnc(c3C#N)Cl)O |
|
Formula | C18 H18 Cl N5 O2 |
Name | 2-chloranyl-4-[[1-methyl-3-[(2~{S})-2-oxidanylbutyl]-2-oxidanylidene-benzimidazol-5-yl]amino]pyridine-3-carbonitrile |
ChEMBL | CHEMBL4550911 |
DrugBank | |
ZINC |
|
PDB chain | 6too Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|