Structure of PDB 6sfg Chain A Binding Site BS02 |
|
|
Ligand ID | FSQ |
InChI | InChI=1S/C8H14O5/c1-8(13)3-4(7(11)12)2-5(9)6(8)10/h4-6,9-10,13H,2-3H2,1H3,(H,11,12)/t4-,5+,6-,8+/m0/s1 |
InChIKey | OFMSIUGUPGSXKY-SKHQTKALSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C@@]1(O)C[C@H](C[C@@H](O)[C@@H]1O)C(O)=O | OpenEye OEToolkits 2.0.6 | C[C@]1(C[C@H](C[C@H]([C@@H]1O)O)C(=O)O)O | OpenEye OEToolkits 2.0.6 | CC1(CC(CC(C1O)O)C(=O)O)O | CACTVS 3.385 | C[C]1(O)C[CH](C[CH](O)[CH]1O)C(O)=O |
|
Formula | C8 H14 O5 |
Name | (1~{S},3~{R},4~{S},5~{R})-3-methyl-3,4,5-tris(hydroxyl)cyclohexane-1-carboxylic Acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6sfg Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E86 H143 K170 |
Catalytic site (residue number reindexed from 1) |
E86 H143 K170 |
Enzyme Commision number |
4.2.1.10: 3-dehydroquinate dehydratase. |
|
|
|