Structure of PDB 6sdi Chain A Binding Site BS02 |
|
|
Ligand ID | 0VV |
InChI | InChI=1S/C8H10N4O2S/c9-15(13,14)12-8-10-5-6-3-1-2-4-7(6)11-8/h1-4H,5H2,(H2,9,13,14)(H2,10,11,12) |
InChIKey | NQQBFHZTZMKZCO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)CN/C(=N\S(=O)(=O)N)/N2 | CACTVS 3.370 | N[S](=O)(=O)N=C1NCc2ccccc2N1 | ACDLabs 12.01 | O=S(=O)(/N=C2/Nc1c(cccc1)CN2)N | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)CNC(=NS(=O)(=O)N)N2 |
|
Formula | C8 H10 N4 O2 S |
Name | N-[(2E)-3,4-dihydroquinazolin-2(1H)-ylidene]sulfuric diamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921354
|
PDB chain | 6sdi Chain A Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|