Structure of PDB 6rzx Chain A Binding Site BS02 |
|
|
Ligand ID | KPQ |
InChI | InChI=1S/C4H2F9NO2S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h(H2,14,15,16) |
InChIKey | FUVKFLJWBHVMHX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N[S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | OpenEye OEToolkits 2.0.7 | C(C(C(F)(F)S(=O)(=O)N)(F)F)(C(F)(F)F)(F)F |
|
Formula | C4 H2 F9 N O2 S |
Name | 1,1,2,2,3,3,4,4,4-nonakis(fluoranyl)butane-1-sulfonamide |
ChEMBL | CHEMBL1076850 |
DrugBank | |
ZINC | ZINC000049672458
|
PDB chain | 6rzx Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|