Structure of PDB 6rq1 Chain A Binding Site BS02 |
|
|
Ligand ID | KE5 |
InChI | InChI=1S/C19H20N2O4/c1-11-8-15(23)7-4-13(11)10-17-19(25)20-16(18(24)21-17)9-12-2-5-14(22)6-3-12/h2-8,16-17,22-23H,9-10H2,1H3,(H,20,25)(H,21,24)/t16-,17-/m0/s1 |
InChIKey | OLLRPTQZHVLIEA-IRXDYDNUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cc1cc(ccc1C[C@H]2C(=O)N[C@H](C(=O)N2)Cc3ccc(cc3)O)O | OpenEye OEToolkits 2.0.7 | Cc1cc(ccc1CC2C(=O)NC(C(=O)N2)Cc3ccc(cc3)O)O | CACTVS 3.385 | Cc1cc(O)ccc1C[C@@H]2NC(=O)[C@H](Cc3ccc(O)cc3)NC2=O | CACTVS 3.385 | Cc1cc(O)ccc1C[CH]2NC(=O)[CH](Cc3ccc(O)cc3)NC2=O |
|
Formula | C19 H20 N2 O4 |
Name | (3~{S},6~{S})-3-[(4-hydroxyphenyl)methyl]-6-[(2-methyl-4-oxidanyl-phenyl)methyl]piperazine-2,5-dione |
ChEMBL | CHEMBL4457675 |
DrugBank | |
ZINC |
|
PDB chain | 6rq1 Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|