Structure of PDB 6p9q Chain A Binding Site BS02 |
|
|
Ligand ID | O5P |
InChI | InChI=1S/C21H22N4O2/c1-15-7-8-22-18(11-15)19-13-20(24-23-19)21(26)25-9-10-27-14-17(25)12-16-5-3-2-4-6-16/h2-8,11,13,17H,9-10,12,14H2,1H3,(H,23,24)/t17-/m1/s1 |
InChIKey | MZWBXVWTKIKBTJ-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | Cc1ccnc(c1)c2cc(n[nH]2)C(=O)N3CCOCC3Cc4ccccc4 | CACTVS 3.385 | Cc1ccnc(c1)c2[nH]nc(c2)C(=O)N3CCOC[C@H]3Cc4ccccc4 | ACDLabs 12.01 | c4(cc(c3cc(C(N2CCOCC2Cc1ccccc1)=O)nn3)ncc4)C | CACTVS 3.385 | Cc1ccnc(c1)c2[nH]nc(c2)C(=O)N3CCOC[CH]3Cc4ccccc4 | OpenEye OEToolkits 2.0.7 | Cc1ccnc(c1)c2cc(n[nH]2)C(=O)N3CCOC[C@H]3Cc4ccccc4 |
|
Formula | C21 H22 N4 O2 |
Name | [(3R)-3-benzylmorpholin-4-yl][5-(4-methylpyridin-2-yl)-1H-pyrazol-3-yl]methanone |
ChEMBL | CHEMBL5208865 |
DrugBank | |
ZINC |
|
PDB chain | 6p9q Chain A Residue 307
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H125 D126 G143 |
Catalytic site (residue number reindexed from 1) |
H125 D126 G143 |
Enzyme Commision number |
2.3.1.129: acyl-[acyl-carrier-protein]--UDP-N-acetylglucosamine O-acyltransferase. |
|
|
|