Structure of PDB 6p29 Chain A Binding Site BS02 |
|
|
Ligand ID | NQ7 |
InChI | InChI=1S/C13H13N3O2/c1-7(11-12(17)16-13(14)18-11)9-6-15-10-5-3-2-4-8(9)10/h2-7,11,15H,1H3,(H2,14,16,17)/t7-,11+/m1/s1 |
InChIKey | JMQXZRUQJGJVSC-HQJQHLMTSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | C[C@H](c1c[nH]c2c1cccc2)[C@H]3C(=O)N=C(O3)N | CACTVS 3.385 | C[CH]([CH]1OC(=NC1=O)N)c2c[nH]c3ccccc23 | ACDLabs 12.01 | c2cccc3ncc(C(C)C1C(=O)N=C(O1)N)c23 | CACTVS 3.385 | C[C@@H]([C@@H]1OC(=NC1=O)N)c2c[nH]c3ccccc23 | OpenEye OEToolkits 2.0.7 | CC(c1c[nH]c2c1cccc2)C3C(=O)N=C(O3)N |
|
Formula | C13 H13 N3 O2 |
Name | (5S)-2-amino-5-[(1R)-1-(1H-indol-3-yl)ethyl]-1,3-oxazol-4(5H)-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6p29 Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|