Structure of PDB 6oum Chain A Binding Site BS02 |
|
|
Ligand ID | N7J |
InChI | InChI=1S/C7H7N3O4S/c8-15(12,13)4-1-2-6-5(3-4)9-7(10-11)14-6/h1-3,11H,(H,9,10)(H2,8,12,13) |
InChIKey | LFVGWDIBDCWZBB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | c1cc2c(cc1S(=O)(=O)N)NC(=NO)O2 | ACDLabs 12.01 | c1c(ccc2c1N/C(O2)=N/O)S(=O)(=O)N | CACTVS 3.385 | N[S](=O)(=O)c1ccc2OC(Nc2c1)=NO | CACTVS 3.385 | N[S](=O)(=O)c1ccc2OC(\Nc2c1)=N/O |
|
Formula | C7 H7 N3 O4 S |
Name | (2Z)-2-(hydroxyimino)-2,3-dihydro-1,3-benzoxazole-5-sulfonamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6oum Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|