Structure of PDB 6oui Chain A Binding Site BS02 |
|
|
|
| Ligand ID | N7D |
| InChI | InChI=1S/C11H17N3O4S/c12-19(17,18)10-5-3-4-9(8-10)14-11(16)13-6-1-2-7-15/h3-5,8,15H,1-2,6-7H2,(H2,12,17,18)(H2,13,14,16) |
| InChIKey | VHNLDERZDZTERH-UHFFFAOYSA-N |
| SMILES | | Software | SMILES |
|---|
| ACDLabs 12.01 | OCCCCNC(Nc1cc(ccc1)S(=O)(=O)N)=O | | CACTVS 3.385 | N[S](=O)(=O)c1cccc(NC(=O)NCCCCO)c1 | | OpenEye OEToolkits 2.0.7 | c1cc(cc(c1)S(=O)(=O)N)NC(=O)NCCCCO |
|
| Formula | C11 H17 N3 O4 S |
| Name | 3-{[(4-hydroxybutyl)carbamoyl]amino}benzene-1-sulfonamide |
| ChEMBL | |
| DrugBank | |
| ZINC |
|
| PDB chain | 6oui Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|
|
|
|
|
