Structure of PDB 6oub Chain A Binding Site BS02 |
|
|
|
| Ligand ID | N7M |
| InChI | InChI=1S/C9H13N3O4S/c10-17(15,16)8-3-1-7(2-4-8)12-9(14)11-5-6-13/h1-4,13H,5-6H2,(H2,10,15,16)(H2,11,12,14) |
| InChIKey | BDPLJVICBWZNIK-UHFFFAOYSA-N |
| SMILES | | Software | SMILES |
|---|
| CACTVS 3.385 | N[S](=O)(=O)c1ccc(NC(=O)NCCO)cc1 | | OpenEye OEToolkits 2.0.7 | c1cc(ccc1NC(=O)NCCO)S(=O)(=O)N | | ACDLabs 12.01 | c1cc(S(=O)(=O)N)ccc1NC(=O)NCCO |
|
| Formula | C9 H13 N3 O4 S |
| Name | 4-{[(2-hydroxyethyl)carbamoyl]amino}benzene-1-sulfonamide |
| ChEMBL | |
| DrugBank | |
| ZINC |
|
| PDB chain | 6oub Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|
|
|
|
|
