Structure of PDB 6o9u Chain A Binding Site BS02 |
|
|
Ligand ID | Z3P |
InChI | InChI=1S/C9H15O7P/c10-7(11)1-4-17(16,5-2-8(12)13)6-3-9(14)15/h1-6H2,(H,10,11)(H,12,13)(H,14,15) |
InChIKey | XJGZCDJZBUBTKW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)CC[P](=O)(CCC(O)=O)CCC(O)=O | ACDLabs 12.01 | O=C(O)CCP(=O)(CCC(=O)O)CCC(=O)O | OpenEye OEToolkits 2.0.4 | C(CP(=O)(CCC(=O)O)CCC(=O)O)C(=O)O |
|
Formula | C9 H15 O7 P |
Name | 3,3',3''-phosphoryltripropanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000145743383
|
PDB chain | 6o9u Chain A Residue 417
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|