Structure of PDB 6mbo Chain A Binding Site BS02 |
|
|
Ligand ID | JDG |
InChI | InChI=1S/C31H49N5O2/c1-23(2)36-17-12-25(13-18-36)33-31-26-20-29(37-3)30(38-19-9-16-35-14-7-8-15-35)21-27(26)34-28(22-32-31)24-10-5-4-6-11-24/h20-21,23-25H,4-19,22H2,1-3H3,(H,32,33) |
InChIKey | CEYUGMZUIYBLTQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COc1cc2C(=NCC(=Nc2cc1OCCCN3CCCC3)C4CCCCC4)NC5CCN(CC5)C(C)C | ACDLabs 12.01 | C1N(CCC1)CCCOc5c(cc2c(N=C(CN=C2NC3CCN(CC3)C(C)C)C4CCCCC4)c5)OC | OpenEye OEToolkits 2.0.6 | CC(C)N1CCC(CC1)NC2=NCC(=Nc3c2cc(c(c3)OCCCN4CCCC4)OC)C5CCCCC5 |
|
Formula | C31 H49 N5 O2 |
Name | 2-cyclohexyl-7-methoxy-N-[1-(propan-2-yl)piperidin-4-yl]-8-[3-(pyrrolidin-1-yl)propoxy]-3H-1,4-benzodiazepin-5-amine |
ChEMBL | CHEMBL4454542 |
DrugBank | |
ZINC |
|
PDB chain | 6mbo Chain A Residue 1302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y1124 Y1211 |
Catalytic site (residue number reindexed from 1) |
Y150 Y237 |
Enzyme Commision number |
2.1.1.- 2.1.1.367: [histone H3]-lysine(9) N-methyltransferase. |
|
|
|